About 4-(4-oxopentyl)benzamide
4-(4-oxopentyl)benzamide (PubChem CID 18473782) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is 4-(4-oxopentyl)benzamide.
Molecular Properties
| Compound Name | 4-(4-oxopentyl)benzamide |
| PubChem CID | 18473782 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 4-(4-oxopentyl)benzamide |
| SMILES | CC(=O)CCCc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C12H15NO2/c1-9(14)3-2-4-10-5-7-11(8-6-10)12(13)15/h5-8H,2-4H2,1H3,(H2,13,15) |
| InChIKey | RMEUUWWRLSEBEX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-oxopentyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-oxopentyl)benzamide?
The IUPAC name of 4-(4-oxopentyl)benzamide (CID 18473782) is 4-(4-oxopentyl)benzamide.
What is the SMILES notation for 4-(4-oxopentyl)benzamide?
The canonical SMILES for 4-(4-oxopentyl)benzamide is CC(=O)CCCc1ccc(C(N)=O)cc1.
What is the InChIKey of 4-(4-oxopentyl)benzamide?
The InChIKey is RMEUUWWRLSEBEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c1-9(14)3-2-4-10-5-7-11(8-6-10)12(13)15/h5-8H,2-4H2,1H3,(H2,13,15).
What are the key properties of 4-(4-oxopentyl)benzamide?
4-(4-oxopentyl)benzamide has a molecular weight of 205.26 g/mol, XLogP of 1.70, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-oxopentyl)benzamide is sourced from PubChem (CID 18473782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).