C17H14Cl2N4O3S — CID 18476476
N-[4-[[3,5-dichloro-4-(cyanomethoxy)phenyl]sulfanylcarbamoylamino]phenyl]acetamide (PubChem CID 18476476) has the molecular formula C17H14Cl2N4O3S and a molecular weight of 425.30 g/mol. Its IUPAC name is N-[4-[[3,5-dichloro-4-(cyanomethoxy)phenyl]sulfanylcarbamoylamino]phenyl]acetamide.
| Compound Name | N-[4-[[3,5-dichloro-4-(cyanomethoxy)phenyl]sulfanylcarbamoylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 18476476 |
| Molecular Formula | C17H14Cl2N4O3S |
| Molecular Weight | 425.30 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | N-[4-[[3,5-dichloro-4-(cyanomethoxy)phenyl]sulfanylcarbamoylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)NSc2cc(Cl)c(OCC#N)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H14Cl2N4O3S/c1-10(24)21-11-2-4-12(5-3-11)22-17(25)23-27-13-8-14(18)16(15(19)9-13)26-7-6-20/h2-5,8-9H,7H2,1H3,(H,21,24)(H2,22,23,25) |
| InChIKey | JAVACUXDWFRYEW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.30 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|