C31H26F3O6P — CID 18510247
[[4-[2-benzyl-2-(4-fluorophenyl)-3-(4-methoxycarbonylphenyl)-3-oxopropyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 18510247) has the molecular formula C31H26F3O6P and a molecular weight of 582.51 g/mol. Its IUPAC name is [[4-[2-benzyl-2-(4-fluorophenyl)-3-(4-methoxycarbonylphenyl)-3-oxopropyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[4-[2-benzyl-2-(4-fluorophenyl)-3-(4-methoxycarbonylphenyl)-3-oxopropyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 18510247 |
| Molecular Formula | C31H26F3O6P |
| Molecular Weight | 582.51 g/mol |
| Exact Mass | 582.14 |
| IUPAC Name | [[4-[2-benzyl-2-(4-fluorophenyl)-3-(4-methoxycarbonylphenyl)-3-oxopropyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | COC(=O)c1ccc(C(=O)C(Cc2ccccc2)(Cc2ccc(C(F)(F)P(=O)(O)O)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C31H26F3O6P/c1-40-29(36)24-11-9-23(10-12-24)28(35)30(19-21-5-3-2-4-6-21,25-15-17-27(32)18-16-25)20-22-7-13-26(14-8-22)31(33,34)41(37,38)39/h2-18H,19-20H2,1H3,(H2,37,38,39) |
| InChIKey | RRJOBXKQVHPDTN-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.51 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|