C11H13NO5 — CID 18515811
oxalic acid;1,2,3,4-tetrahydroisoquinolin-6-ol (PubChem CID 18515811) has the molecular formula C11H13NO5 and a molecular weight of 239.23 g/mol. Its IUPAC name is oxalic acid;1,2,3,4-tetrahydroisoquinolin-6-ol.
| Compound Name | oxalic acid;1,2,3,4-tetrahydroisoquinolin-6-ol |
|---|---|
| PubChem CID | 18515811 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | oxalic acid;1,2,3,4-tetrahydroisoquinolin-6-ol |
| SMILES | O=C(O)C(=O)O.Oc1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/C9H11NO.C2H2O4/c11-9-2-1-8-6-10-4-3-7(8)5-9;3-1(4)2(5)6/h1-2,5,10-11H,3-4,6H2;(H,3,4)(H,5,6) |
| InChIKey | DHXIZAXLUNSRID-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|