C17H24IN3O3 — CID 18528195
diethyl-methyl-[2-(3-methyl-4-oxophthalazine-1-carbonyl)oxyethyl]azanium iodide (PubChem CID 18528195) has the molecular formula C17H24IN3O3 and a molecular weight of 445.30 g/mol. Its IUPAC name is diethyl-methyl-[2-(3-methyl-4-oxophthalazine-1-carbonyl)oxyethyl]azanium iodide.
| Compound Name | diethyl-methyl-[2-(3-methyl-4-oxophthalazine-1-carbonyl)oxyethyl]azanium iodide |
|---|---|
| PubChem CID | 18528195 |
| Molecular Formula | C17H24IN3O3 |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | diethyl-methyl-[2-(3-methyl-4-oxophthalazine-1-carbonyl)oxyethyl]azanium iodide |
| SMILES | CC[N+](C)(CC)CCOC(=O)c1nn(C)c(=O)c2ccccc12.[I-] |
| InChI | InChI=1S/C17H24N3O3.HI/c1-5-20(4,6-2)11-12-23-17(22)15-13-9-7-8-10-14(13)16(21)19(3)18-15;/h7-10H,5-6,11-12H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | WMCHHWGHUHTEAG-UHFFFAOYSA-M |
| XLogP | -1.42 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|