C16H15Cl2IN4S — CID 18528903
[(E)-(4-chlorophenyl)methylideneamino]-[(E)-N-[(E)-(4-chlorophenyl)methylideneamino]-C-methylsulfanylcarbonimidoyl]azanium iodide (PubChem CID 18528903) has the molecular formula C16H15Cl2IN4S and a molecular weight of 493.20 g/mol. Its IUPAC name is [(E)-(4-chlorophenyl)methylideneamino]-[(E)-N-[(E)-(4-chlorophenyl)methylideneamino]-C-methylsulfanylcarbonimidoyl]azanium iodide.
| Compound Name | [(E)-(4-chlorophenyl)methylideneamino]-[(E)-N-[(E)-(4-chlorophenyl)methylideneamino]-C-methylsulfanylcarbonimidoyl]azanium iodide |
|---|---|
| PubChem CID | 18528903 |
| Molecular Formula | C16H15Cl2IN4S |
| Molecular Weight | 493.20 g/mol |
| Exact Mass | 491.94 |
| IUPAC Name | [(E)-(4-chlorophenyl)methylideneamino]-[(E)-N-[(E)-(4-chlorophenyl)methylideneamino]-C-methylsulfanylcarbonimidoyl]azanium iodide |
| SMILES | CS/C(=N/N=C/c1ccc(Cl)cc1)[NH2+]/N=C/c1ccc(Cl)cc1.[I-] |
| InChI | InChI=1S/C16H14Cl2N4S.HI/c1-23-16(21-19-10-12-2-6-14(17)7-3-12)22-20-11-13-4-8-15(18)9-5-13;/h2-11H,1H3,(H,21,22);1H/b19-10+,20-11+; |
| InChIKey | SCRCHDNXUDSPOB-YMMOLGQLSA-N |
| XLogP | 0.65 |
| TPSA | 53.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.20 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|