C22H18Cl3IN6 — CID 73449227
[(4-chlorophenyl)methylideneamino]-[N-[(3-chlorophenyl)methylideneamino]-N'-[(4-chlorophenyl)methylideneamino]carbamimidoyl]azanium iodide (PubChem CID 73449227) has the molecular formula C22H18Cl3IN6 and a molecular weight of 599.69 g/mol. Its IUPAC name is [(4-chlorophenyl)methylideneamino]-[N-[(3-chlorophenyl)methylideneamino]-N'-[(4-chlorophenyl)methylideneamino]carbamimidoyl]azanium iodide.
| Compound Name | [(4-chlorophenyl)methylideneamino]-[N-[(3-chlorophenyl)methylideneamino]-N'-[(4-chlorophenyl)methylideneamino]carbamimidoyl]azanium iodide |
|---|---|
| PubChem CID | 73449227 |
| Molecular Formula | C22H18Cl3IN6 |
| Molecular Weight | 599.69 g/mol |
| Exact Mass | 597.97 |
| IUPAC Name | [(4-chlorophenyl)methylideneamino]-[N-[(3-chlorophenyl)methylideneamino]-N'-[(4-chlorophenyl)methylideneamino]carbamimidoyl]azanium iodide |
| SMILES | Clc1ccc(C=NN=C(NN=Cc2cccc(Cl)c2)[NH2+]N=Cc2ccc(Cl)cc2)cc1.[I-] |
| InChI | InChI=1S/C22H17Cl3N6.HI/c23-19-8-4-16(5-9-19)13-26-29-22(30-27-14-17-6-10-20(24)11-7-17)31-28-15-18-2-1-3-21(25)12-18;/h1-15H,(H2,29,30,31);1H |
| InChIKey | IMSXQAXMFIBOPO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.69 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|