C15H17N3O5 — CID 18531221
ethyl (2Z)-3-amino-2-[5-(4-methoxyphenyl)-3-methyl-1,3,4-oxadiazol-2-ylidene]-3-oxopropanoate (PubChem CID 18531221) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is ethyl (2Z)-3-amino-2-[5-(4-methoxyphenyl)-3-methyl-1,3,4-oxadiazol-2-ylidene]-3-oxopropanoate.
| Compound Name | ethyl (2Z)-3-amino-2-[5-(4-methoxyphenyl)-3-methyl-1,3,4-oxadiazol-2-ylidene]-3-oxopropanoate |
|---|---|
| PubChem CID | 18531221 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | ethyl (2Z)-3-amino-2-[5-(4-methoxyphenyl)-3-methyl-1,3,4-oxadiazol-2-ylidene]-3-oxopropanoate |
| SMILES | CCOC(=O)/C(C(N)=O)=C1\OC(c2ccc(OC)cc2)=NN1C |
| InChI | InChI=1S/C15H17N3O5/c1-4-22-15(20)11(12(16)19)14-18(2)17-13(23-14)9-5-7-10(21-3)8-6-9/h5-8H,4H2,1-3H3,(H2,16,19)/b14-11- |
| InChIKey | ABMFBJSLJIYSNA-KAMYIIQDSA-N |
| XLogP | 0.58 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|