C17H21NO — CID 18533371
3-amino-4,4-diphenylpentan-2-ol (PubChem CID 18533371) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is 3-amino-4,4-diphenylpentan-2-ol.
| Compound Name | 3-amino-4,4-diphenylpentan-2-ol |
|---|---|
| PubChem CID | 18533371 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 3-amino-4,4-diphenylpentan-2-ol |
| SMILES | CC(O)C(N)C(C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H21NO/c1-13(19)16(18)17(2,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-13,16,19H,18H2,1-2H3 |
| InChIKey | WYVDUHPBHPTGSW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |