C20H20N4S2 — CID 18537301
4-[(9-ethylcarbazol-3-yl)amino]-5-methylsulfanylthiophene-2-carboximidamide (PubChem CID 18537301) has the molecular formula C20H20N4S2 and a molecular weight of 380.54 g/mol. Its IUPAC name is 4-[(9-ethylcarbazol-3-yl)amino]-5-methylsulfanylthiophene-2-carboximidamide.
| Compound Name | 4-[(9-ethylcarbazol-3-yl)amino]-5-methylsulfanylthiophene-2-carboximidamide |
|---|---|
| PubChem CID | 18537301 |
| Molecular Formula | C20H20N4S2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 4-[(9-ethylcarbazol-3-yl)amino]-5-methylsulfanylthiophene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(Nc2ccc3c(c2)c2ccccc2n3CC)c(SC)s1 |
| InChI | InChI=1S/C20H20N4S2/c1-3-24-16-7-5-4-6-13(16)14-10-12(8-9-17(14)24)23-15-11-18(19(21)22)26-20(15)25-2/h4-11,23H,3H2,1-2H3,(H3,21,22) |
| InChIKey | ADXZXWZFGQXOHF-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|