C15H17N3O3S2 — CID 18537451
N-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)-2-(2-hydroxy-5-methoxyphenyl)acetamide (PubChem CID 18537451) has the molecular formula C15H17N3O3S2 and a molecular weight of 351.45 g/mol. Its IUPAC name is N-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)-2-(2-hydroxy-5-methoxyphenyl)acetamide.
| Compound Name | N-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)-2-(2-hydroxy-5-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 18537451 |
| Molecular Formula | C15H17N3O3S2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | N-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)-2-(2-hydroxy-5-methoxyphenyl)acetamide |
| SMILES | [H]/N=C(\N)c1cc(NC(=O)Cc2cc(OC)ccc2O)c(SC)s1 |
| InChI | InChI=1S/C15H17N3O3S2/c1-21-9-3-4-11(19)8(5-9)6-13(20)18-10-7-12(14(16)17)23-15(10)22-2/h3-5,7,19H,6H2,1-2H3,(H3,16,17)(H,18,20) |
| InChIKey | YZGGGNOCHRXGGI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 108.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|