C17H13Cl2N3O3S2 — CID 18536778
N-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)-5-(3,5-dichlorophenoxy)furan-2-carboxamide (PubChem CID 18536778) has the molecular formula C17H13Cl2N3O3S2 and a molecular weight of 442.35 g/mol. Its IUPAC name is N-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)-5-(3,5-dichlorophenoxy)furan-2-carboxamide.
| Compound Name | N-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)-5-(3,5-dichlorophenoxy)furan-2-carboxamide |
|---|---|
| PubChem CID | 18536778 |
| Molecular Formula | C17H13Cl2N3O3S2 |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 440.98 |
| IUPAC Name | N-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)-5-(3,5-dichlorophenoxy)furan-2-carboxamide |
| SMILES | [H]/N=C(\N)c1cc(NC(=O)c2ccc(Oc3cc(Cl)cc(Cl)c3)o2)c(SC)s1 |
| InChI | InChI=1S/C17H13Cl2N3O3S2/c1-26-17-11(7-13(27-17)15(20)21)22-16(23)12-2-3-14(25-12)24-10-5-8(18)4-9(19)6-10/h2-7H,1H3,(H3,20,21)(H,22,23) |
| InChIKey | YRGRHPABOBAFHO-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|