C13H16O8 — CID 18539506
3-[1,1-bis(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropanoic acid (PubChem CID 18539506) has the molecular formula C13H16O8 and a molecular weight of 300.26 g/mol. Its IUPAC name is 3-[1,1-bis(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropanoic acid.
| Compound Name | 3-[1,1-bis(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 18539506 |
| Molecular Formula | C13H16O8 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 3-[1,1-bis(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropanoic acid |
| SMILES | C=C(C)C(=O)OC(C)(OC(=O)CC(=O)O)OC(=O)C(=C)C |
| InChI | InChI=1S/C13H16O8/c1-7(2)11(17)20-13(5,21-12(18)8(3)4)19-10(16)6-9(14)15/h1,3,6H2,2,4-5H3,(H,14,15) |
| InChIKey | MMHKDAUOFDGMSF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|