C14H16O8 — CID 18539493
(E)-4-[1,1-bis(2-methylprop-2-enoyloxy)ethoxy]-4-oxobut-2-enoic acid (PubChem CID 18539493) has the molecular formula C14H16O8 and a molecular weight of 312.27 g/mol. Its IUPAC name is (E)-4-[1,1-bis(2-methylprop-2-enoyloxy)ethoxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[1,1-bis(2-methylprop-2-enoyloxy)ethoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 18539493 |
| Molecular Formula | C14H16O8 |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | (E)-4-[1,1-bis(2-methylprop-2-enoyloxy)ethoxy]-4-oxobut-2-enoic acid |
| SMILES | C=C(C)C(=O)OC(C)(OC(=O)/C=C/C(=O)O)OC(=O)C(=C)C |
| InChI | InChI=1S/C14H16O8/c1-8(2)12(18)21-14(5,22-13(19)9(3)4)20-11(17)7-6-10(15)16/h6-7H,1,3H2,2,4-5H3,(H,15,16)/b7-6+ |
| InChIKey | SPWCJOUHYSIGNW-VOTSOKGWSA-N |
| XLogP | 1.08 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|