C28H33ClN2O5 — CID 18545828
6-chloro-3-[1-[(4-propan-2-yloxy-2,3-dihydro-1H-inden-2-yl)methyl]piperidin-4-yl]-1H-indole;oxalic acid (PubChem CID 18545828) has the molecular formula C28H33ClN2O5 and a molecular weight of 513.03 g/mol. Its IUPAC name is 6-chloro-3-[1-[(4-propan-2-yloxy-2,3-dihydro-1H-inden-2-yl)methyl]piperidin-4-yl]-1H-indole;oxalic acid.
| Compound Name | 6-chloro-3-[1-[(4-propan-2-yloxy-2,3-dihydro-1H-inden-2-yl)methyl]piperidin-4-yl]-1H-indole;oxalic acid |
|---|---|
| PubChem CID | 18545828 |
| Molecular Formula | C28H33ClN2O5 |
| Molecular Weight | 513.03 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | 6-chloro-3-[1-[(4-propan-2-yloxy-2,3-dihydro-1H-inden-2-yl)methyl]piperidin-4-yl]-1H-indole;oxalic acid |
| SMILES | CC(C)Oc1cccc2c1CC(CN1CCC(c3c[nH]c4cc(Cl)ccc34)CC1)C2.O=C(O)C(=O)O |
| InChI | InChI=1S/C26H31ClN2O.C2H2O4/c1-17(2)30-26-5-3-4-20-12-18(13-23(20)26)16-29-10-8-19(9-11-29)24-15-28-25-14-21(27)6-7-22(24)25;3-1(4)2(5)6/h3-7,14-15,17-19,28H,8-13,16H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | MNPXTVZERNHJPA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 102.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.03 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|