C21H14F8N2O8 — CID 18546641
(E)-3-[4-[6-(2,4-dinitrophenoxy)-2,2,3,3,4,4,5,5-octafluorohexoxy]phenyl]prop-2-enoic acid (PubChem CID 18546641) has the molecular formula C21H14F8N2O8 and a molecular weight of 574.33 g/mol. Its IUPAC name is (E)-3-[4-[6-(2,4-dinitrophenoxy)-2,2,3,3,4,4,5,5-octafluorohexoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[6-(2,4-dinitrophenoxy)-2,2,3,3,4,4,5,5-octafluorohexoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 18546641 |
| Molecular Formula | C21H14F8N2O8 |
| Molecular Weight | 574.33 g/mol |
| Exact Mass | 574.06 |
| IUPAC Name | (E)-3-[4-[6-(2,4-dinitrophenoxy)-2,2,3,3,4,4,5,5-octafluorohexoxy]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)COc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H14F8N2O8/c22-18(23,10-38-14-5-1-12(2-6-14)3-8-17(32)33)20(26,27)21(28,29)19(24,25)11-39-16-7-4-13(30(34)35)9-15(16)31(36)37/h1-9H,10-11H2,(H,32,33)/b8-3+ |
| InChIKey | FFDSPFRVVMINGK-FPYGCLRLSA-N |
| XLogP | 5.60 |
| TPSA | 142.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.33 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|