C26H15F8N3O8 — CID 18546635
(4-cyanophenyl) 4-[6-(2,4-dinitrophenoxy)-2,2,3,3,4,4,5,5-octafluorohexoxy]benzoate (PubChem CID 18546635) has the molecular formula C26H15F8N3O8 and a molecular weight of 649.40 g/mol. Its IUPAC name is (4-cyanophenyl) 4-[6-(2,4-dinitrophenoxy)-2,2,3,3,4,4,5,5-octafluorohexoxy]benzoate.
| Compound Name | (4-cyanophenyl) 4-[6-(2,4-dinitrophenoxy)-2,2,3,3,4,4,5,5-octafluorohexoxy]benzoate |
|---|---|
| PubChem CID | 18546635 |
| Molecular Formula | C26H15F8N3O8 |
| Molecular Weight | 649.40 g/mol |
| Exact Mass | 649.07 |
| IUPAC Name | (4-cyanophenyl) 4-[6-(2,4-dinitrophenoxy)-2,2,3,3,4,4,5,5-octafluorohexoxy]benzoate |
| SMILES | N#Cc1ccc(OC(=O)c2ccc(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)COc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C26H15F8N3O8/c27-23(28,13-43-18-8-3-16(4-9-18)22(38)45-19-6-1-15(12-35)2-7-19)25(31,32)26(33,34)24(29,30)14-44-21-10-5-17(36(39)40)11-20(21)37(41)42/h1-11H,13-14H2 |
| InChIKey | HZQRQGCGTXFNTK-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 154.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.40 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|