C19H15F8N3O2 — CID 20675264
4-[6-(2,5-diaminophenoxy)-2,2,3,3,4,4,5,5-octafluorohexoxy]benzonitrile (PubChem CID 20675264) has the molecular formula C19H15F8N3O2 and a molecular weight of 469.33 g/mol. Its IUPAC name is 4-[6-(2,5-diaminophenoxy)-2,2,3,3,4,4,5,5-octafluorohexoxy]benzonitrile.
| Compound Name | 4-[6-(2,5-diaminophenoxy)-2,2,3,3,4,4,5,5-octafluorohexoxy]benzonitrile |
|---|---|
| PubChem CID | 20675264 |
| Molecular Formula | C19H15F8N3O2 |
| Molecular Weight | 469.33 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | 4-[6-(2,5-diaminophenoxy)-2,2,3,3,4,4,5,5-octafluorohexoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)COc2cc(N)ccc2N)cc1 |
| InChI | InChI=1S/C19H15F8N3O2/c20-16(21,9-31-13-4-1-11(8-28)2-5-13)18(24,25)19(26,27)17(22,23)10-32-15-7-12(29)3-6-14(15)30/h1-7H,9-10,29-30H2 |
| InChIKey | VKNORTKOTVQUIU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 94.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.33 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|