C22H27N3O5 — CID 18556206
(1S,2R,6R,7S,8R,12S)-5-(2,3-dimethoxyphenyl)-10-[2-(dimethylamino)ethyl]-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione (PubChem CID 18556206) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is (1S,2R,6R,7S,8R,12S)-5-(2,3-dimethoxyphenyl)-10-[2-(dimethylamino)ethyl]-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione.
| Compound Name | (1S,2R,6R,7S,8R,12S)-5-(2,3-dimethoxyphenyl)-10-[2-(dimethylamino)ethyl]-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione |
|---|---|
| PubChem CID | 18556206 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | (1S,2R,6R,7S,8R,12S)-5-(2,3-dimethoxyphenyl)-10-[2-(dimethylamino)ethyl]-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione |
| SMILES | COc1cccc(C2=NO[C@@H]3[C@H]4C[C@H]([C@H]5C(=O)N(CCN(C)C)C(=O)[C@@H]45)[C@H]23)c1OC |
| InChI | InChI=1S/C22H27N3O5/c1-24(2)8-9-25-21(26)15-12-10-13(16(15)22(25)27)20-17(12)18(23-30-20)11-6-5-7-14(28-3)19(11)29-4/h5-7,12-13,15-17,20H,8-10H2,1-4H3/t12-,13+,15-,16+,17-,20-/m1/s1 |
| InChIKey | PDGGZHFADDVANG-XDWVOIJPSA-N |
| XLogP | 1.24 |
| TPSA | 80.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|