C23H19N3O2 — CID 18566181
N-(2,6-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)-4-phenylbenzamide (PubChem CID 18566181) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is N-(2,6-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)-4-phenylbenzamide.
| Compound Name | N-(2,6-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)-4-phenylbenzamide |
|---|---|
| PubChem CID | 18566181 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-(2,6-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)-4-phenylbenzamide |
| SMILES | Cc1nc2cccc(C)n2c(=O)c1NC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H19N3O2/c1-15-7-6-10-20-24-16(2)21(23(28)26(15)20)25-22(27)19-13-11-18(12-14-19)17-8-4-3-5-9-17/h3-14H,1-2H3,(H,25,27) |
| InChIKey | WFNMQEYXXJLMOT-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |