C21H16ClN3O — CID 23792325
2-chloro-N-(5-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)benzamide (PubChem CID 23792325) has the molecular formula C21H16ClN3O and a molecular weight of 361.83 g/mol. Its IUPAC name is 2-chloro-N-(5-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)benzamide.
| Compound Name | 2-chloro-N-(5-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)benzamide |
|---|---|
| PubChem CID | 23792325 |
| Molecular Formula | C21H16ClN3O |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 2-chloro-N-(5-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)benzamide |
| SMILES | Cc1cccc2nc(-c3ccccc3)c(NC(=O)c3ccccc3Cl)n12 |
| InChI | InChI=1S/C21H16ClN3O/c1-14-8-7-13-18-23-19(15-9-3-2-4-10-15)20(25(14)18)24-21(26)16-11-5-6-12-17(16)22/h2-13H,1H3,(H,24,26) |
| InChIKey | PHZXXRCTLZPDRZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |