C21H20ClNO4S — CID 18586059
4-(4-chlorophenyl)sulfonyl-N-(4-methoxynaphthalen-1-yl)butanamide (PubChem CID 18586059) has the molecular formula C21H20ClNO4S and a molecular weight of 417.91 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfonyl-N-(4-methoxynaphthalen-1-yl)butanamide.
| Compound Name | 4-(4-chlorophenyl)sulfonyl-N-(4-methoxynaphthalen-1-yl)butanamide |
|---|---|
| PubChem CID | 18586059 |
| Molecular Formula | C21H20ClNO4S |
| Molecular Weight | 417.91 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 4-(4-chlorophenyl)sulfonyl-N-(4-methoxynaphthalen-1-yl)butanamide |
| SMILES | COc1ccc(NC(=O)CCCS(=O)(=O)c2ccc(Cl)cc2)c2ccccc12 |
| InChI | InChI=1S/C21H20ClNO4S/c1-27-20-13-12-19(17-5-2-3-6-18(17)20)23-21(24)7-4-14-28(25,26)16-10-8-15(22)9-11-16/h2-3,5-6,8-13H,4,7,14H2,1H3,(H,23,24) |
| InChIKey | PAOAYHBTEXXUGD-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.91 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |