C18H16ClN7O4S — CID 18593329
1-[(4-chlorophenyl)methyl]-3,7-dimethyl-8-(3-methyl-5-nitroimidazol-4-yl)sulfanylpurine-2,6-dione (PubChem CID 18593329) has the molecular formula C18H16ClN7O4S and a molecular weight of 461.89 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3,7-dimethyl-8-(3-methyl-5-nitroimidazol-4-yl)sulfanylpurine-2,6-dione.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3,7-dimethyl-8-(3-methyl-5-nitroimidazol-4-yl)sulfanylpurine-2,6-dione |
|---|---|
| PubChem CID | 18593329 |
| Molecular Formula | C18H16ClN7O4S |
| Molecular Weight | 461.89 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3,7-dimethyl-8-(3-methyl-5-nitroimidazol-4-yl)sulfanylpurine-2,6-dione |
| SMILES | Cn1cnc([N+](=O)[O-])c1Sc1nc2c(c(=O)n(Cc3ccc(Cl)cc3)c(=O)n2C)n1C |
| InChI | InChI=1S/C18H16ClN7O4S/c1-22-9-20-14(26(29)30)16(22)31-17-21-13-12(23(17)2)15(27)25(18(28)24(13)3)8-10-4-6-11(19)7-5-10/h4-7,9H,8H2,1-3H3 |
| InChIKey | FTDOXNTXRCCNQP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 122.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.89 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|