C17H24O5 — CID 18597827
(3aR,5R,6S,6aR)-5-ethyl-6-(furan-3-ylmethoxy)spiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane] (PubChem CID 18597827) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-5-ethyl-6-(furan-3-ylmethoxy)spiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane].
| Compound Name | (3aR,5R,6S,6aR)-5-ethyl-6-(furan-3-ylmethoxy)spiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane] |
|---|---|
| PubChem CID | 18597827 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (3aR,5R,6S,6aR)-5-ethyl-6-(furan-3-ylmethoxy)spiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane] |
| SMILES | CC[C@H]1O[C@@H]2OC3(CCCCC3)O[C@@H]2[C@H]1OCc1ccoc1 |
| InChI | InChI=1S/C17H24O5/c1-2-13-14(19-11-12-6-9-18-10-12)15-16(20-13)22-17(21-15)7-4-3-5-8-17/h6,9-10,13-16H,2-5,7-8,11H2,1H3/t13-,14+,15-,16-/m1/s1 |
| InChIKey | HJRGXGUVCUNMPE-QKPAOTATSA-N |
| XLogP | 3.38 |
| TPSA | 50.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |