C13H21NO2 — CID 18601013
tert-butyl (2S,3aR)-2,3,3a,4,5,7a-hexahydro-1H-indole-2-carboxylate (PubChem CID 18601013) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is tert-butyl (2S,3aR)-2,3,3a,4,5,7a-hexahydro-1H-indole-2-carboxylate.
| Compound Name | tert-butyl (2S,3aR)-2,3,3a,4,5,7a-hexahydro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 18601013 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | tert-butyl (2S,3aR)-2,3,3a,4,5,7a-hexahydro-1H-indole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C[C@H]2CCC=CC2N1 |
| InChI | InChI=1S/C13H21NO2/c1-13(2,3)16-12(15)11-8-9-6-4-5-7-10(9)14-11/h5,7,9-11,14H,4,6,8H2,1-3H3/t9-,10?,11+/m1/s1 |
| InChIKey | PSWCPHQYKZUVED-FBKFWFMHSA-N |
| XLogP | 2.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|