C26H52N2O5 — CID 18603718
(3S)-3-amino-4-oxo-4-[[2-(2,2,4,4-tetramethylpentan-3-yloxymethyl)cyclopropyl]amino]butanoic acid;2,2,4,4-tetramethylpentan-3-ol (PubChem CID 18603718) has the molecular formula C26H52N2O5 and a molecular weight of 472.71 g/mol. Its IUPAC name is (3S)-3-amino-4-oxo-4-[[2-(2,2,4,4-tetramethylpentan-3-yloxymethyl)cyclopropyl]amino]butanoic acid;2,2,4,4-tetramethylpentan-3-ol.
| Compound Name | (3S)-3-amino-4-oxo-4-[[2-(2,2,4,4-tetramethylpentan-3-yloxymethyl)cyclopropyl]amino]butanoic acid;2,2,4,4-tetramethylpentan-3-ol |
|---|---|
| PubChem CID | 18603718 |
| Molecular Formula | C26H52N2O5 |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 472.39 |
| IUPAC Name | (3S)-3-amino-4-oxo-4-[[2-(2,2,4,4-tetramethylpentan-3-yloxymethyl)cyclopropyl]amino]butanoic acid;2,2,4,4-tetramethylpentan-3-ol |
| SMILES | CC(C)(C)C(O)C(C)(C)C.CC(C)(C)C(OCC1CC1NC(=O)[C@@H](N)CC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C17H32N2O4.C9H20O/c1-16(2,3)15(17(4,5)6)23-9-10-7-12(10)19-14(22)11(18)8-13(20)21;1-8(2,3)7(10)9(4,5)6/h10-12,15H,7-9,18H2,1-6H3,(H,19,22)(H,20,21);7,10H,1-6H3/t10?,11-,12?;/m0./s1 |
| InChIKey | GJDVBFSWPFNUAH-QUPZBEGFSA-N |
| XLogP | 4.21 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |