C25H52N2O6 — CID 18603709
(3S)-3-amino-4-[[1-hydroxy-3-(2,2,4,4-tetramethylpentan-3-yloxy)propan-2-yl]amino]-4-oxobutanoic acid;2,2,4,4-tetramethylpentan-3-ol (PubChem CID 18603709) has the molecular formula C25H52N2O6 and a molecular weight of 476.70 g/mol. Its IUPAC name is (3S)-3-amino-4-[[1-hydroxy-3-(2,2,4,4-tetramethylpentan-3-yloxy)propan-2-yl]amino]-4-oxobutanoic acid;2,2,4,4-tetramethylpentan-3-ol.
| Compound Name | (3S)-3-amino-4-[[1-hydroxy-3-(2,2,4,4-tetramethylpentan-3-yloxy)propan-2-yl]amino]-4-oxobutanoic acid;2,2,4,4-tetramethylpentan-3-ol |
|---|---|
| PubChem CID | 18603709 |
| Molecular Formula | C25H52N2O6 |
| Molecular Weight | 476.70 g/mol |
| Exact Mass | 476.38 |
| IUPAC Name | (3S)-3-amino-4-[[1-hydroxy-3-(2,2,4,4-tetramethylpentan-3-yloxy)propan-2-yl]amino]-4-oxobutanoic acid;2,2,4,4-tetramethylpentan-3-ol |
| SMILES | CC(C)(C)C(O)C(C)(C)C.CC(C)(C)C(OCC(CO)NC(=O)[C@@H](N)CC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C16H32N2O5.C9H20O/c1-15(2,3)14(16(4,5)6)23-9-10(8-19)18-13(22)11(17)7-12(20)21;1-8(2,3)7(10)9(4,5)6/h10-11,14,19H,7-9,17H2,1-6H3,(H,18,22)(H,20,21);7,10H,1-6H3/t10?,11-;/m0./s1 |
| InChIKey | XMDXGJQJFCOISW-GQNCZFCYSA-N |
| XLogP | 3.18 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.70 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |