C19H22N2O3SSe — CID 18604982
methyl (2S)-2-amino-3-methyl-3-[2-(phenylcarbamoyl)phenyl]selanylsulfanylbutanoate (PubChem CID 18604982) has the molecular formula C19H22N2O3SSe and a molecular weight of 437.42 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-methyl-3-[2-(phenylcarbamoyl)phenyl]selanylsulfanylbutanoate.
| Compound Name | methyl (2S)-2-amino-3-methyl-3-[2-(phenylcarbamoyl)phenyl]selanylsulfanylbutanoate |
|---|---|
| PubChem CID | 18604982 |
| Molecular Formula | C19H22N2O3SSe |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | methyl (2S)-2-amino-3-methyl-3-[2-(phenylcarbamoyl)phenyl]selanylsulfanylbutanoate |
| SMILES | COC(=O)[C@H](N)C(C)(C)S[Se]c1ccccc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C19H22N2O3SSe/c1-19(2,16(20)18(23)24-3)25-26-15-12-8-7-11-14(15)17(22)21-13-9-5-4-6-10-13/h4-12,16H,20H2,1-3H3,(H,21,22)/t16-/m0/s1 |
| InChIKey | JEMACMHTMXLPSA-INIZCTEOSA-N |
| XLogP | 2.20 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|