C18H21ClN2O3SSe — CID 53239430
ethyl (2R)-2-amino-3-[2-(phenylcarbamoyl)phenyl]selanylsulfanylpropanoate;hydrochloride (PubChem CID 53239430) has the molecular formula C18H21ClN2O3SSe and a molecular weight of 459.86 g/mol. Its IUPAC name is ethyl (2R)-2-amino-3-[2-(phenylcarbamoyl)phenyl]selanylsulfanylpropanoate;hydrochloride.
| Compound Name | ethyl (2R)-2-amino-3-[2-(phenylcarbamoyl)phenyl]selanylsulfanylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 53239430 |
| Molecular Formula | C18H21ClN2O3SSe |
| Molecular Weight | 459.86 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | ethyl (2R)-2-amino-3-[2-(phenylcarbamoyl)phenyl]selanylsulfanylpropanoate;hydrochloride |
| SMILES | CCOC(=O)[C@@H](N)CS[Se]c1ccccc1C(=O)Nc1ccccc1.Cl |
| InChI | InChI=1S/C18H20N2O3SSe.ClH/c1-2-23-18(22)15(19)12-24-25-16-11-7-6-10-14(16)17(21)20-13-8-4-3-5-9-13;/h3-11,15H,2,12,19H2,1H3,(H,20,21);1H/t15-;/m0./s1 |
| InChIKey | UBWLNXUWIVBIJZ-RSAXXLAASA-N |
| XLogP | 2.23 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.86 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|