C16H16N2O3SSe — CID 18604983
(2R)-2-amino-3-[2-(phenylcarbamoyl)phenyl]selanylsulfanylpropanoic acid (PubChem CID 18604983) has the molecular formula C16H16N2O3SSe and a molecular weight of 395.34 g/mol. Its IUPAC name is (2R)-2-amino-3-[2-(phenylcarbamoyl)phenyl]selanylsulfanylpropanoic acid.
| Compound Name | (2R)-2-amino-3-[2-(phenylcarbamoyl)phenyl]selanylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 18604983 |
| Molecular Formula | C16H16N2O3SSe |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 396.00 |
| IUPAC Name | (2R)-2-amino-3-[2-(phenylcarbamoyl)phenyl]selanylsulfanylpropanoic acid |
| SMILES | N[C@@H](CS[Se]c1ccccc1C(=O)Nc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H16N2O3SSe/c17-13(16(20)21)10-22-23-14-9-5-4-8-12(14)15(19)18-11-6-2-1-3-7-11/h1-9,13H,10,17H2,(H,18,19)(H,20,21)/t13-/m0/s1 |
| InChIKey | DRBNAVSHXVOSJT-ZDUSSCGKSA-N |
| XLogP | 1.33 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|