C12H16N4O2 — CID 18613467
[2-amino-4-cyano-5-[methyl(propan-2-yl)amino]phenyl]carbamic acid (PubChem CID 18613467) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is [2-amino-4-cyano-5-[methyl(propan-2-yl)amino]phenyl]carbamic acid.
| Compound Name | [2-amino-4-cyano-5-[methyl(propan-2-yl)amino]phenyl]carbamic acid |
|---|---|
| PubChem CID | 18613467 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | [2-amino-4-cyano-5-[methyl(propan-2-yl)amino]phenyl]carbamic acid |
| SMILES | CC(C)N(C)c1cc(NC(=O)O)c(N)cc1C#N |
| InChI | InChI=1S/C12H16N4O2/c1-7(2)16(3)11-5-10(15-12(17)18)9(14)4-8(11)6-13/h4-5,7,15H,14H2,1-3H3,(H,17,18) |
| InChIKey | QEQWXELMGNCDLR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 102.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|