C15H14Cl3N5 — CID 18616882
2-[(6-chloro-1H-benzimidazol-2-yl)methyl]-1H-benzimidazol-4-amine;dihydrochloride (PubChem CID 18616882) has the molecular formula C15H14Cl3N5 and a molecular weight of 370.67 g/mol. Its IUPAC name is 2-[(6-chloro-1H-benzimidazol-2-yl)methyl]-1H-benzimidazol-4-amine;dihydrochloride.
| Compound Name | 2-[(6-chloro-1H-benzimidazol-2-yl)methyl]-1H-benzimidazol-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 18616882 |
| Molecular Formula | C15H14Cl3N5 |
| Molecular Weight | 370.67 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | 2-[(6-chloro-1H-benzimidazol-2-yl)methyl]-1H-benzimidazol-4-amine;dihydrochloride |
| SMILES | Cl.Cl.Nc1cccc2[nH]c(Cc3nc4ccc(Cl)cc4[nH]3)nc12 |
| InChI | InChI=1S/C15H12ClN5.2ClH/c16-8-4-5-10-12(6-8)20-13(18-10)7-14-19-11-3-1-2-9(17)15(11)21-14;;/h1-6H,7,17H2,(H,18,20)(H,19,21);2*1H |
| InChIKey | ZVURPSWMLXEYIK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.67 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|