C17H24N2O3S2 — CID 18618333
(1-benzylsulfonyl-4-sulfanylpyrrolidin-2-yl)-piperidin-1-ylmethanone (PubChem CID 18618333) has the molecular formula C17H24N2O3S2 and a molecular weight of 368.52 g/mol. Its IUPAC name is (1-benzylsulfonyl-4-sulfanylpyrrolidin-2-yl)-piperidin-1-ylmethanone.
| Compound Name | (1-benzylsulfonyl-4-sulfanylpyrrolidin-2-yl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 18618333 |
| Molecular Formula | C17H24N2O3S2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | (1-benzylsulfonyl-4-sulfanylpyrrolidin-2-yl)-piperidin-1-ylmethanone |
| SMILES | O=C(C1CC(S)CN1S(=O)(=O)Cc1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C17H24N2O3S2/c20-17(18-9-5-2-6-10-18)16-11-15(23)12-19(16)24(21,22)13-14-7-3-1-4-8-14/h1,3-4,7-8,15-16,23H,2,5-6,9-13H2 |
| InChIKey | XXWWMJWAFCRHIW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 57.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|