C15H12F6N2O2S — CID 18620460
4-methyl-2-[[2-(trifluoromethyl)-4-pyridinyl]oxy]-6-[2-(trifluoromethylsulfanyl)ethoxy]pyridine (PubChem CID 18620460) has the molecular formula C15H12F6N2O2S and a molecular weight of 398.33 g/mol. Its IUPAC name is 4-methyl-2-[[2-(trifluoromethyl)-4-pyridinyl]oxy]-6-[2-(trifluoromethylsulfanyl)ethoxy]pyridine.
| Compound Name | 4-methyl-2-[[2-(trifluoromethyl)-4-pyridinyl]oxy]-6-[2-(trifluoromethylsulfanyl)ethoxy]pyridine |
|---|---|
| PubChem CID | 18620460 |
| Molecular Formula | C15H12F6N2O2S |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 4-methyl-2-[[2-(trifluoromethyl)-4-pyridinyl]oxy]-6-[2-(trifluoromethylsulfanyl)ethoxy]pyridine |
| SMILES | Cc1cc(OCCSC(F)(F)F)nc(Oc2ccnc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C15H12F6N2O2S/c1-9-6-12(24-4-5-26-15(19,20)21)23-13(7-9)25-10-2-3-22-11(8-10)14(16,17)18/h2-3,6-8H,4-5H2,1H3 |
| InChIKey | PFUJCTAGBOKODL-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|