C15H13F5N2O4S — CID 18620457
2-[[2-(difluoromethoxy)-4-pyridinyl]oxy]-4-methoxy-6-[2-(trifluoromethylsulfanyl)ethoxy]pyridine (PubChem CID 18620457) has the molecular formula C15H13F5N2O4S and a molecular weight of 412.34 g/mol. Its IUPAC name is 2-[[2-(difluoromethoxy)-4-pyridinyl]oxy]-4-methoxy-6-[2-(trifluoromethylsulfanyl)ethoxy]pyridine.
| Compound Name | 2-[[2-(difluoromethoxy)-4-pyridinyl]oxy]-4-methoxy-6-[2-(trifluoromethylsulfanyl)ethoxy]pyridine |
|---|---|
| PubChem CID | 18620457 |
| Molecular Formula | C15H13F5N2O4S |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | 2-[[2-(difluoromethoxy)-4-pyridinyl]oxy]-4-methoxy-6-[2-(trifluoromethylsulfanyl)ethoxy]pyridine |
| SMILES | COc1cc(OCCSC(F)(F)F)nc(Oc2ccnc(OC(F)F)c2)c1 |
| InChI | InChI=1S/C15H13F5N2O4S/c1-23-10-7-12(24-4-5-27-15(18,19)20)22-13(8-10)25-9-2-3-21-11(6-9)26-14(16)17/h2-3,6-8,14H,4-5H2,1H3 |
| InChIKey | QBZZKOVVIGUVJM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|