C29H40O2Si2 — CID 18622650
[3,3-bis(1H-inden-1-yl)-5-trimethylsilyloxypentoxy]-trimethylsilane (PubChem CID 18622650) has the molecular formula C29H40O2Si2 and a molecular weight of 476.81 g/mol. Its IUPAC name is [3,3-bis(1H-inden-1-yl)-5-trimethylsilyloxypentoxy]-trimethylsilane.
| Compound Name | [3,3-bis(1H-inden-1-yl)-5-trimethylsilyloxypentoxy]-trimethylsilane |
|---|---|
| PubChem CID | 18622650 |
| Molecular Formula | C29H40O2Si2 |
| Molecular Weight | 476.81 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | [3,3-bis(1H-inden-1-yl)-5-trimethylsilyloxypentoxy]-trimethylsilane |
| SMILES | C[Si](C)(C)OCCC(CCO[Si](C)(C)C)(C1C=Cc2ccccc21)C1C=Cc2ccccc21 |
| InChI | InChI=1S/C29H40O2Si2/c1-32(2,3)30-21-19-29(20-22-31-33(4,5)6,27-17-15-23-11-7-9-13-25(23)27)28-18-16-24-12-8-10-14-26(24)28/h7-18,27-28H,19-22H2,1-6H3 |
| InChIKey | NCRMSRHZTWJSGB-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.81 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|