C15H22ClN3O2 — CID 18626944
3-[(4-hydroxy-1H-indole-6-carbonyl)amino]propyl-trimethylazanium chloride (PubChem CID 18626944) has the molecular formula C15H22ClN3O2 and a molecular weight of 311.81 g/mol. Its IUPAC name is 3-[(4-hydroxy-1H-indole-6-carbonyl)amino]propyl-trimethylazanium chloride.
| Compound Name | 3-[(4-hydroxy-1H-indole-6-carbonyl)amino]propyl-trimethylazanium chloride |
|---|---|
| PubChem CID | 18626944 |
| Molecular Formula | C15H22ClN3O2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 3-[(4-hydroxy-1H-indole-6-carbonyl)amino]propyl-trimethylazanium chloride |
| SMILES | C[N+](C)(C)CCCNC(=O)c1cc(O)c2cc[nH]c2c1.[Cl-] |
| InChI | InChI=1S/C15H21N3O2.ClH/c1-18(2,3)8-4-6-17-15(20)11-9-13-12(5-7-16-13)14(19)10-11;/h5,7,9-10H,4,6,8H2,1-3H3,(H2-,16,17,19,20);1H |
| InChIKey | PMLUGTRERVMQKK-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|