C16H24N3O2+ — CID 18626942
3-[(4-hydroxy-1-methylindole-2-carbonyl)amino]propyl-trimethylazanium (PubChem CID 18626942) has the molecular formula C16H24N3O2+ and a molecular weight of 290.39 g/mol. Its IUPAC name is 3-[(4-hydroxy-1-methylindole-2-carbonyl)amino]propyl-trimethylazanium.
| Compound Name | 3-[(4-hydroxy-1-methylindole-2-carbonyl)amino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 18626942 |
| Molecular Formula | C16H24N3O2+ |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 3-[(4-hydroxy-1-methylindole-2-carbonyl)amino]propyl-trimethylazanium |
| SMILES | Cn1c(C(=O)NCCC[N+](C)(C)C)cc2c(O)cccc21 |
| InChI | InChI=1S/C16H23N3O2/c1-18-13-7-5-8-15(20)12(13)11-14(18)16(21)17-9-6-10-19(2,3)4/h5,7-8,11H,6,9-10H2,1-4H3,(H-,17,20,21)/p+1 |
| InChIKey | CWIRBCFWQINTMF-UHFFFAOYSA-O |
| XLogP | 1.71 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|