C14H21NO4 — CID 18637868
(2R,3S,4R,6R)-2-[(benzylamino)methyl]-6-methoxyoxane-3,4-diol (PubChem CID 18637868) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is (2R,3S,4R,6R)-2-[(benzylamino)methyl]-6-methoxyoxane-3,4-diol.
| Compound Name | (2R,3S,4R,6R)-2-[(benzylamino)methyl]-6-methoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 18637868 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | (2R,3S,4R,6R)-2-[(benzylamino)methyl]-6-methoxyoxane-3,4-diol |
| SMILES | CO[C@H]1C[C@@H](O)[C@H](O)[C@@H](CNCc2ccccc2)O1 |
| InChI | InChI=1S/C14H21NO4/c1-18-13-7-11(16)14(17)12(19-13)9-15-8-10-5-3-2-4-6-10/h2-6,11-17H,7-9H2,1H3/t11-,12-,13-,14+/m1/s1 |
| InChIKey | HRQWGMUGSZMBAG-SYQHCUMBSA-N |
| XLogP | 0.26 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |