C25H33FN2O — CID 18639418
2-[(1S)-2-[2-(3-fluorophenyl)pentan-2-yl]cyclopropyl]-N-(4-pyridin-3-ylbutyl)acetamide (PubChem CID 18639418) has the molecular formula C25H33FN2O and a molecular weight of 396.55 g/mol. Its IUPAC name is 2-[(1S)-2-[2-(3-fluorophenyl)pentan-2-yl]cyclopropyl]-N-(4-pyridin-3-ylbutyl)acetamide.
| Compound Name | 2-[(1S)-2-[2-(3-fluorophenyl)pentan-2-yl]cyclopropyl]-N-(4-pyridin-3-ylbutyl)acetamide |
|---|---|
| PubChem CID | 18639418 |
| Molecular Formula | C25H33FN2O |
| Molecular Weight | 396.55 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 2-[(1S)-2-[2-(3-fluorophenyl)pentan-2-yl]cyclopropyl]-N-(4-pyridin-3-ylbutyl)acetamide |
| SMILES | CCCC(C)(c1cccc(F)c1)C1C[C@H]1CC(=O)NCCCCc1cccnc1 |
| InChI | InChI=1S/C25H33FN2O/c1-3-12-25(2,21-10-6-11-22(26)17-21)23-15-20(23)16-24(29)28-14-5-4-8-19-9-7-13-27-18-19/h6-7,9-11,13,17-18,20,23H,3-5,8,12,14-16H2,1-2H3,(H,28,29)/t20-,23?,25?/m0/s1 |
| InChIKey | IQSALSAWTOAMDD-UPDUBSDMSA-N |
| XLogP | 5.44 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.55 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|