C26H33FN2O — CID 23051372
(E)-3-[1-[2-(4-fluorophenyl)pentan-2-yl]cyclopropyl]-N-(4-pyridin-3-ylbutyl)prop-2-enamide (PubChem CID 23051372) has the molecular formula C26H33FN2O and a molecular weight of 408.56 g/mol. Its IUPAC name is (E)-3-[1-[2-(4-fluorophenyl)pentan-2-yl]cyclopropyl]-N-(4-pyridin-3-ylbutyl)prop-2-enamide.
| Compound Name | (E)-3-[1-[2-(4-fluorophenyl)pentan-2-yl]cyclopropyl]-N-(4-pyridin-3-ylbutyl)prop-2-enamide |
|---|---|
| PubChem CID | 23051372 |
| Molecular Formula | C26H33FN2O |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | (E)-3-[1-[2-(4-fluorophenyl)pentan-2-yl]cyclopropyl]-N-(4-pyridin-3-ylbutyl)prop-2-enamide |
| SMILES | CCCC(C)(c1ccc(F)cc1)C1(/C=C/C(=O)NCCCCc2cccnc2)CC1 |
| InChI | InChI=1S/C26H33FN2O/c1-3-14-25(2,22-9-11-23(27)12-10-22)26(16-17-26)15-13-24(30)29-19-5-4-7-21-8-6-18-28-20-21/h6,8-13,15,18,20H,3-5,7,14,16-17,19H2,1-2H3,(H,29,30)/b15-13+ |
| InChIKey | PRCNSSVKNHVEAD-FYWRMAATSA-N |
| XLogP | 5.75 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|