C24H32N2OS — CID 22840497
3-[(1S,2S)-2-pentyl-2-thiophen-3-ylcyclopropyl]-N-(4-pyridin-3-ylbutyl)prop-2-enamide (PubChem CID 22840497) has the molecular formula C24H32N2OS and a molecular weight of 396.60 g/mol. Its IUPAC name is 3-[(1S,2S)-2-pentyl-2-thiophen-3-ylcyclopropyl]-N-(4-pyridin-3-ylbutyl)prop-2-enamide.
| Compound Name | 3-[(1S,2S)-2-pentyl-2-thiophen-3-ylcyclopropyl]-N-(4-pyridin-3-ylbutyl)prop-2-enamide |
|---|---|
| PubChem CID | 22840497 |
| Molecular Formula | C24H32N2OS |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 3-[(1S,2S)-2-pentyl-2-thiophen-3-ylcyclopropyl]-N-(4-pyridin-3-ylbutyl)prop-2-enamide |
| SMILES | CCCCC[C@]1(c2ccsc2)C[C@H]1C=CC(=O)NCCCCc1cccnc1 |
| InChI | InChI=1S/C24H32N2OS/c1-2-3-5-13-24(22-12-16-28-19-22)17-21(24)10-11-23(27)26-15-6-4-8-20-9-7-14-25-18-20/h7,9-12,14,16,18-19,21H,2-6,8,13,15,17H2,1H3,(H,26,27)/t21-,24+/m1/s1 |
| InChIKey | DBKBSTRMRKOFOS-QPPBQGQZSA-N |
| XLogP | 5.68 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|