C35H37NO6 — CID 18641853
[5-[(2S)-3-oxo-3-phenylmethoxy-2-(phenylmethoxyamino)propyl]-2-phenylmethoxyphenyl] 2,2-dimethylpropanoate (PubChem CID 18641853) has the molecular formula C35H37NO6 and a molecular weight of 567.68 g/mol. Its IUPAC name is [5-[(2S)-3-oxo-3-phenylmethoxy-2-(phenylmethoxyamino)propyl]-2-phenylmethoxyphenyl] 2,2-dimethylpropanoate.
| Compound Name | [5-[(2S)-3-oxo-3-phenylmethoxy-2-(phenylmethoxyamino)propyl]-2-phenylmethoxyphenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 18641853 |
| Molecular Formula | C35H37NO6 |
| Molecular Weight | 567.68 g/mol |
| Exact Mass | 567.26 |
| IUPAC Name | [5-[(2S)-3-oxo-3-phenylmethoxy-2-(phenylmethoxyamino)propyl]-2-phenylmethoxyphenyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1cc(C[C@H](NOCc2ccccc2)C(=O)OCc2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C35H37NO6/c1-35(2,3)34(38)42-32-22-29(19-20-31(32)39-23-26-13-7-4-8-14-26)21-30(36-41-25-28-17-11-6-12-18-28)33(37)40-24-27-15-9-5-10-16-27/h4-20,22,30,36H,21,23-25H2,1-3H3/t30-/m0/s1 |
| InChIKey | UXJBKFWKSVJGAM-PMERELPUSA-N |
| XLogP | 6.59 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.68 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|