C27H31NO3 — CID 71217588
ethyl (2S)-2-(methylamino)-3-[4-(2-phenylethyl)-3-phenylmethoxyphenyl]propanoate (PubChem CID 71217588) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is ethyl (2S)-2-(methylamino)-3-[4-(2-phenylethyl)-3-phenylmethoxyphenyl]propanoate.
| Compound Name | ethyl (2S)-2-(methylamino)-3-[4-(2-phenylethyl)-3-phenylmethoxyphenyl]propanoate |
|---|---|
| PubChem CID | 71217588 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | ethyl (2S)-2-(methylamino)-3-[4-(2-phenylethyl)-3-phenylmethoxyphenyl]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(CCc2ccccc2)c(OCc2ccccc2)c1)NC |
| InChI | InChI=1S/C27H31NO3/c1-3-30-27(29)25(28-2)18-23-15-17-24(16-14-21-10-6-4-7-11-21)26(19-23)31-20-22-12-8-5-9-13-22/h4-13,15,17,19,25,28H,3,14,16,18,20H2,1-2H3/t25-/m0/s1 |
| InChIKey | WNTKVZIBWKQNAO-VWLOTQADSA-N |
| XLogP | 4.74 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |