C28H36N4O4S — CID 18643516
[(3S,4R)-6-cyano-4-(2-cyanoimino-1,3-thiazolidin-3-yl)-2,2-dimethyl-3,4-dihydrochromen-3-yl] 2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetate (PubChem CID 18643516) has the molecular formula C28H36N4O4S and a molecular weight of 524.69 g/mol. Its IUPAC name is [(3S,4R)-6-cyano-4-(2-cyanoimino-1,3-thiazolidin-3-yl)-2,2-dimethyl-3,4-dihydrochromen-3-yl] 2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetate.
| Compound Name | [(3S,4R)-6-cyano-4-(2-cyanoimino-1,3-thiazolidin-3-yl)-2,2-dimethyl-3,4-dihydrochromen-3-yl] 2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetate |
|---|---|
| PubChem CID | 18643516 |
| Molecular Formula | C28H36N4O4S |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | [(3S,4R)-6-cyano-4-(2-cyanoimino-1,3-thiazolidin-3-yl)-2,2-dimethyl-3,4-dihydrochromen-3-yl] 2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetate |
| SMILES | CC1CCC(C(C)C)C(OCC(=O)O[C@H]2[C@H](N3CCS/C3=N\C#N)c3cc(C#N)ccc3OC2(C)C)C1 |
| InChI | InChI=1S/C28H36N4O4S/c1-17(2)20-8-6-18(3)12-23(20)34-15-24(33)35-26-25(32-10-11-37-27(32)31-16-30)21-13-19(14-29)7-9-22(21)36-28(26,4)5/h7,9,13,17-18,20,23,25-26H,6,8,10-12,15H2,1-5H3/b31-27-/t18?,20?,23?,25-,26+/m1/s1 |
| InChIKey | HGLOAFRMKWAPGK-PLAVYPEHSA-N |
| XLogP | 5.05 |
| TPSA | 107.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|