C17H30O8 — CID 18643768
(5-methyl-2-propan-2-ylcyclohexyl) [(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] carbonate (PubChem CID 18643768) has the molecular formula C17H30O8 and a molecular weight of 362.42 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) [(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] carbonate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) [(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] carbonate |
|---|---|
| PubChem CID | 18643768 |
| Molecular Formula | C17H30O8 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) [(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] carbonate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)OC(C=O)[C@@H](O)[C@H](O)[C@H](O)CO)C1 |
| InChI | InChI=1S/C17H30O8/c1-9(2)11-5-4-10(3)6-13(11)24-17(23)25-14(8-19)16(22)15(21)12(20)7-18/h8-16,18,20-22H,4-7H2,1-3H3/t10?,11?,12-,13?,14?,15-,16-/m1/s1 |
| InChIKey | LIXAPJRYPHUDNI-CBXFUCDASA-N |
| XLogP | 0.24 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|