C20H22N2O7 — CID 18644285
[(3R,4S)-2,2-dimethyl-6-nitro-4-(5-oxo-3-prop-2-enoxy-2H-pyrrol-1-yl)-3,4-dihydrochromen-3-yl] acetate (PubChem CID 18644285) has the molecular formula C20H22N2O7 and a molecular weight of 402.40 g/mol. Its IUPAC name is [(3R,4S)-2,2-dimethyl-6-nitro-4-(5-oxo-3-prop-2-enoxy-2H-pyrrol-1-yl)-3,4-dihydrochromen-3-yl] acetate.
| Compound Name | [(3R,4S)-2,2-dimethyl-6-nitro-4-(5-oxo-3-prop-2-enoxy-2H-pyrrol-1-yl)-3,4-dihydrochromen-3-yl] acetate |
|---|---|
| PubChem CID | 18644285 |
| Molecular Formula | C20H22N2O7 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | [(3R,4S)-2,2-dimethyl-6-nitro-4-(5-oxo-3-prop-2-enoxy-2H-pyrrol-1-yl)-3,4-dihydrochromen-3-yl] acetate |
| SMILES | C=CCOC1=CC(=O)N([C@H]2c3cc([N+](=O)[O-])ccc3OC(C)(C)[C@@H]2OC(C)=O)C1 |
| InChI | InChI=1S/C20H22N2O7/c1-5-8-27-14-10-17(24)21(11-14)18-15-9-13(22(25)26)6-7-16(15)29-20(3,4)19(18)28-12(2)23/h5-7,9-10,18-19H,1,8,11H2,2-4H3/t18-,19+/m0/s1 |
| InChIKey | WMKBYPDZAGEIBH-RBUKOAKNSA-N |
| XLogP | 2.67 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|