C26H34N2O5 — CID 67924160
[(3S,4R)-6-cyano-2,2-diethyl-4-(3-hexoxy-5-oxo-2H-pyrrol-1-yl)-3,4-dihydrochromen-3-yl] acetate (PubChem CID 67924160) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is [(3S,4R)-6-cyano-2,2-diethyl-4-(3-hexoxy-5-oxo-2H-pyrrol-1-yl)-3,4-dihydrochromen-3-yl] acetate.
| Compound Name | [(3S,4R)-6-cyano-2,2-diethyl-4-(3-hexoxy-5-oxo-2H-pyrrol-1-yl)-3,4-dihydrochromen-3-yl] acetate |
|---|---|
| PubChem CID | 67924160 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | [(3S,4R)-6-cyano-2,2-diethyl-4-(3-hexoxy-5-oxo-2H-pyrrol-1-yl)-3,4-dihydrochromen-3-yl] acetate |
| SMILES | CCCCCCOC1=CC(=O)N([C@@H]2c3cc(C#N)ccc3OC(CC)(CC)[C@H]2OC(C)=O)C1 |
| InChI | InChI=1S/C26H34N2O5/c1-5-8-9-10-13-31-20-15-23(30)28(17-20)24-21-14-19(16-27)11-12-22(21)33-26(6-2,7-3)25(24)32-18(4)29/h11-12,14-15,24-25H,5-10,13,17H2,1-4H3/t24-,25+/m1/s1 |
| InChIKey | YLVVJTWOZLRENU-RPBOFIJWSA-N |
| XLogP | 4.81 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|