C21H26N2O7 — CID 18644292
[(3R,4S)-4-(3-butoxy-5-oxo-2H-pyrrol-1-yl)-2,2-dimethyl-6-nitro-3,4-dihydrochromen-3-yl] acetate (PubChem CID 18644292) has the molecular formula C21H26N2O7 and a molecular weight of 418.45 g/mol. Its IUPAC name is [(3R,4S)-4-(3-butoxy-5-oxo-2H-pyrrol-1-yl)-2,2-dimethyl-6-nitro-3,4-dihydrochromen-3-yl] acetate.
| Compound Name | [(3R,4S)-4-(3-butoxy-5-oxo-2H-pyrrol-1-yl)-2,2-dimethyl-6-nitro-3,4-dihydrochromen-3-yl] acetate |
|---|---|
| PubChem CID | 18644292 |
| Molecular Formula | C21H26N2O7 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | [(3R,4S)-4-(3-butoxy-5-oxo-2H-pyrrol-1-yl)-2,2-dimethyl-6-nitro-3,4-dihydrochromen-3-yl] acetate |
| SMILES | CCCCOC1=CC(=O)N([C@H]2c3cc([N+](=O)[O-])ccc3OC(C)(C)[C@@H]2OC(C)=O)C1 |
| InChI | InChI=1S/C21H26N2O7/c1-5-6-9-28-15-11-18(25)22(12-15)19-16-10-14(23(26)27)7-8-17(16)30-21(3,4)20(19)29-13(2)24/h7-8,10-11,19-20H,5-6,9,12H2,1-4H3/t19-,20+/m0/s1 |
| InChIKey | VXRQCSIPQPYJJV-VQTJNVASSA-N |
| XLogP | 3.28 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|