C25H27Cl2NO3 — CID 18645339
4-[(2R)-2-[bis[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenol (PubChem CID 18645339) has the molecular formula C25H27Cl2NO3 and a molecular weight of 460.40 g/mol. Its IUPAC name is 4-[(2R)-2-[bis[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenol.
| Compound Name | 4-[(2R)-2-[bis[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenol |
|---|---|
| PubChem CID | 18645339 |
| Molecular Formula | C25H27Cl2NO3 |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 4-[(2R)-2-[bis[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenol |
| SMILES | C[C@H](Cc1ccc(O)cc1)N(C[C@H](O)c1cccc(Cl)c1)C[C@H](O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H27Cl2NO3/c1-17(12-18-8-10-23(29)11-9-18)28(15-24(30)19-4-2-6-21(26)13-19)16-25(31)20-5-3-7-22(27)14-20/h2-11,13-14,17,24-25,29-31H,12,15-16H2,1H3/t17-,24+,25+/m1/s1 |
| InChIKey | NGENWRCJTDTEEE-XATISFHKSA-N |
| XLogP | 5.40 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |